About (Z)-2-N-ethyl-1-N,1-N,2-N-trimethylbut-1-ene-1,2-diamine
(Z)-2-N-ethyl-1-N,1-N,2-N-trimethylbut-1-ene-1,2-diamine (PubChem CID 87430189) has the molecular formula C9H20N2
and a molecular weight of 156.27 g/mol. Its IUPAC name is (Z)-2-N-ethyl-1-N,1-N,2-N-trimethylbut-1-ene-1,2-diamine.
Molecular Properties
| Compound Name | (Z)-2-N-ethyl-1-N,1-N,2-N-trimethylbut-1-ene-1,2-diamine |
| PubChem CID | 87430189 |
| Molecular Formula | C9H20N2 |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.16 |
| IUPAC Name | (Z)-2-N-ethyl-1-N,1-N,2-N-trimethylbut-1-ene-1,2-diamine |
| SMILES | CC/C(=C/N(C)C)N(C)CC |
| InChI | InChI=1S/C9H20N2/c1-6-9(8-10(3)4)11(5)7-2/h8H,6-7H2,1-5H3/b9-8- |
| InChIKey | XWLVMPUTKJCMEL-HJWRWDBZSA-N |
| XLogP | 1.75 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (Z)-2-N-ethyl-1-N,1-N,2-N-trimethylbut-1-ene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-N-ethyl-1-N,1-N,2-N-trimethylbut-1-ene-1,2-diamine?
The IUPAC name of (Z)-2-N-ethyl-1-N,1-N,2-N-trimethylbut-1-ene-1,2-diamine (CID 87430189) is (Z)-2-N-ethyl-1-N,1-N,2-N-trimethylbut-1-ene-1,2-diamine.
What is the SMILES notation for (Z)-2-N-ethyl-1-N,1-N,2-N-trimethylbut-1-ene-1,2-diamine?
The canonical SMILES for (Z)-2-N-ethyl-1-N,1-N,2-N-trimethylbut-1-ene-1,2-diamine is CC/C(=C/N(C)C)N(C)CC.
What is the InChIKey of (Z)-2-N-ethyl-1-N,1-N,2-N-trimethylbut-1-ene-1,2-diamine?
The InChIKey is XWLVMPUTKJCMEL-HJWRWDBZSA-N. The full InChI is InChI=1S/C9H20N2/c1-6-9(8-10(3)4)11(5)7-2/h8H,6-7H2,1-5H3/b9-8-.
What are the key properties of (Z)-2-N-ethyl-1-N,1-N,2-N-trimethylbut-1-ene-1,2-diamine?
(Z)-2-N-ethyl-1-N,1-N,2-N-trimethylbut-1-ene-1,2-diamine has a molecular weight of 156.27 g/mol, XLogP of 1.75, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-N-ethyl-1-N,1-N,2-N-trimethylbut-1-ene-1,2-diamine is sourced from PubChem (CID 87430189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).