About (Z)-1-N,1-N,2-N,2-N-tetramethylbut-1-ene-1,2-diamine
(Z)-1-N,1-N,2-N,2-N-tetramethylbut-1-ene-1,2-diamine (PubChem CID 87430195) has the molecular formula C8H18N2
and a molecular weight of 142.25 g/mol. Its IUPAC name is (Z)-1-N,1-N,2-N,2-N-tetramethylbut-1-ene-1,2-diamine.
Analyze (Z)-1-N,1-N,2-N,2-N-tetramethylbut-1-ene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-N,1-N,2-N,2-N-tetramethylbut-1-ene-1,2-diamine?
The IUPAC name of (Z)-1-N,1-N,2-N,2-N-tetramethylbut-1-ene-1,2-diamine (CID 87430195) is (Z)-1-N,1-N,2-N,2-N-tetramethylbut-1-ene-1,2-diamine.
What is the SMILES notation for (Z)-1-N,1-N,2-N,2-N-tetramethylbut-1-ene-1,2-diamine?
The canonical SMILES for (Z)-1-N,1-N,2-N,2-N-tetramethylbut-1-ene-1,2-diamine is CC/C(=C/N(C)C)N(C)C.
What is the InChIKey of (Z)-1-N,1-N,2-N,2-N-tetramethylbut-1-ene-1,2-diamine?
The InChIKey is IYVUCCUQAVPKQW-FPLPWBNLSA-N. The full InChI is InChI=1S/C8H18N2/c1-6-8(10(4)5)7-9(2)3/h7H,6H2,1-5H3/b8-7-.
What are the key properties of (Z)-1-N,1-N,2-N,2-N-tetramethylbut-1-ene-1,2-diamine?
(Z)-1-N,1-N,2-N,2-N-tetramethylbut-1-ene-1,2-diamine has a molecular weight of 142.25 g/mol, XLogP of 1.36, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-N,1-N,2-N,2-N-tetramethylbut-1-ene-1,2-diamine is sourced from PubChem (CID 87430195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).