C7H7NS3 — CID 87430206
3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione (PubChem CID 87430206) has the molecular formula C7H7NS3 and a molecular weight of 201.34 g/mol. Its IUPAC name is 3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione.
| Compound Name | 3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione |
|---|---|
| PubChem CID | 87430206 |
| Molecular Formula | C7H7NS3 |
| Molecular Weight | 201.34 g/mol |
| Exact Mass | 200.97 |
| IUPAC Name | 3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione |
| SMILES | S=C1C=C2SCCC2C(=S)N1 |
| InChI | InChI=1S/C7H7NS3/c9-6-3-5-4(1-2-11-5)7(10)8-6/h3-4H,1-2H2,(H,8,9,10) |
| InChIKey | YDJQUKOREQIYGD-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.34 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|