About 6-methylidene-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4-thione
6-methylidene-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4-thione (PubChem CID 87430225) has the molecular formula C8H9NS2
and a molecular weight of 183.30 g/mol. Its IUPAC name is 6-methylidene-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4-thione.
Molecular Properties
| Compound Name | 6-methylidene-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4-thione |
| PubChem CID | 87430225 |
| Molecular Formula | C8H9NS2 |
| Molecular Weight | 183.30 g/mol |
| Exact Mass | 183.02 |
| IUPAC Name | 6-methylidene-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4-thione |
| SMILES | C=C1C=C2SCCC2C(=S)N1 |
| InChI | InChI=1S/C8H9NS2/c1-5-4-7-6(2-3-11-7)8(10)9-5/h4,6H,1-3H2,(H,9,10) |
| InChIKey | SVVACVVTWUEKOR-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.30 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 6-methylidene-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylidene-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4-thione?
The IUPAC name of 6-methylidene-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4-thione (CID 87430225) is 6-methylidene-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4-thione.
What is the SMILES notation for 6-methylidene-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4-thione?
The canonical SMILES for 6-methylidene-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4-thione is C=C1C=C2SCCC2C(=S)N1.
What is the InChIKey of 6-methylidene-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4-thione?
The InChIKey is SVVACVVTWUEKOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NS2/c1-5-4-7-6(2-3-11-7)8(10)9-5/h4,6H,1-3H2,(H,9,10).
What are the key properties of 6-methylidene-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4-thione?
6-methylidene-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4-thione has a molecular weight of 183.30 g/mol, XLogP of 2.07, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylidene-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4-thione is sourced from PubChem (CID 87430225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).