C10H9BO4 — CID 87430373
(4S,5S)-2-phenyl-1,3,2-dioxaborolane-4,5-dicarbaldehyde (PubChem CID 87430373) has the molecular formula C10H9BO4 and a molecular weight of 203.99 g/mol. Its IUPAC name is (4S,5S)-2-phenyl-1,3,2-dioxaborolane-4,5-dicarbaldehyde.
| Compound Name | (4S,5S)-2-phenyl-1,3,2-dioxaborolane-4,5-dicarbaldehyde |
|---|---|
| PubChem CID | 87430373 |
| Molecular Formula | C10H9BO4 |
| Molecular Weight | 203.99 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | (4S,5S)-2-phenyl-1,3,2-dioxaborolane-4,5-dicarbaldehyde |
| SMILES | O=C[C@H]1OB(c2ccccc2)O[C@@H]1C=O |
| InChI | InChI=1S/C10H9BO4/c12-6-9-10(7-13)15-11(14-9)8-4-2-1-3-5-8/h1-7,9-10H/t9-,10-/m1/s1 |
| InChIKey | ZPAHUEPFFQDJIG-NXEZZACHSA-N |
| XLogP | -0.44 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.99 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|