C15H24N2O6 — CID 87430389
methyl (4S,5R)-5-methyl-2-[2-[(4R,5R)-5-methyl-4-(methylperoxymethyl)-4,5-dihydro-1,3-oxazol-2-yl]propan-2-yl]-4,5-dihydro-1,3-oxazole-4-carboxylate (PubChem CID 87430389) has the molecular formula C15H24N2O6 and a molecular weight of 328.37 g/mol. Its IUPAC name is methyl (4S,5R)-5-methyl-2-[2-[(4R,5R)-5-methyl-4-(methylperoxymethyl)-4,5-dihydro-1,3-oxazol-2-yl]propan-2-yl]-4,5-dihydro-1,3-oxazole-4-carboxylate.
| Compound Name | methyl (4S,5R)-5-methyl-2-[2-[(4R,5R)-5-methyl-4-(methylperoxymethyl)-4,5-dihydro-1,3-oxazol-2-yl]propan-2-yl]-4,5-dihydro-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 87430389 |
| Molecular Formula | C15H24N2O6 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | methyl (4S,5R)-5-methyl-2-[2-[(4R,5R)-5-methyl-4-(methylperoxymethyl)-4,5-dihydro-1,3-oxazol-2-yl]propan-2-yl]-4,5-dihydro-1,3-oxazole-4-carboxylate |
| SMILES | COOC[C@H]1N=C(C(C)(C)C2=N[C@H](C(=O)OC)[C@@H](C)O2)O[C@@H]1C |
| InChI | InChI=1S/C15H24N2O6/c1-8-10(7-21-20-6)16-13(22-8)15(3,4)14-17-11(9(2)23-14)12(18)19-5/h8-11H,7H2,1-6H3/t8-,9-,10-,11+/m1/s1 |
| InChIKey | ZBLPEYYSJNEAKV-DBIOUOCHSA-N |
| XLogP | 1.14 |
| TPSA | 87.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|