C23H29NO6 — CID 8743104
[(2R)-1-(4-acetyl-3,5-dimethyl-1H-pyrrol-2-yl)-1-oxopropan-2-yl] 4-butoxy-3-methoxybenzoate (PubChem CID 8743104) has the molecular formula C23H29NO6 and a molecular weight of 415.49 g/mol. Its IUPAC name is [(2R)-1-(4-acetyl-3,5-dimethyl-1H-pyrrol-2-yl)-1-oxopropan-2-yl] 4-butoxy-3-methoxybenzoate.
| Compound Name | [(2R)-1-(4-acetyl-3,5-dimethyl-1H-pyrrol-2-yl)-1-oxopropan-2-yl] 4-butoxy-3-methoxybenzoate |
|---|---|
| PubChem CID | 8743104 |
| Molecular Formula | C23H29NO6 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | [(2R)-1-(4-acetyl-3,5-dimethyl-1H-pyrrol-2-yl)-1-oxopropan-2-yl] 4-butoxy-3-methoxybenzoate |
| SMILES | CCCCOc1ccc(C(=O)O[C@H](C)C(=O)c2[nH]c(C)c(C(C)=O)c2C)cc1OC |
| InChI | InChI=1S/C23H29NO6/c1-7-8-11-29-18-10-9-17(12-19(18)28-6)23(27)30-16(5)22(26)21-13(2)20(15(4)25)14(3)24-21/h9-10,12,16,24H,7-8,11H2,1-6H3/t16-/m1/s1 |
| InChIKey | KRBMFQAGFJYSBK-MRXNPFEDSA-N |
| XLogP | 4.45 |
| TPSA | 94.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|