C48H44F6O6S2 — CID 87431275
1-[4-[1-[4-[1,1,1,3,3,3-hexafluoro-2-[4-[4-[4-(2-methylbutan-2-yl)phenyl]sulfonylphenoxy]phenyl]propan-2-yl]phenoxy]propyl]phenyl]sulfonyl-4-methylbenzene (PubChem CID 87431275) has the molecular formula C48H44F6O6S2 and a molecular weight of 895.00 g/mol. Its IUPAC name is 1-[4-[1-[4-[1,1,1,3,3,3-hexafluoro-2-[4-[4-[4-(2-methylbutan-2-yl)phenyl]sulfonylphenoxy]phenyl]propan-2-yl]phenoxy]propyl]phenyl]sulfonyl-4-methylbenzene.
| Compound Name | 1-[4-[1-[4-[1,1,1,3,3,3-hexafluoro-2-[4-[4-[4-(2-methylbutan-2-yl)phenyl]sulfonylphenoxy]phenyl]propan-2-yl]phenoxy]propyl]phenyl]sulfonyl-4-methylbenzene |
|---|---|
| PubChem CID | 87431275 |
| Molecular Formula | C48H44F6O6S2 |
| Molecular Weight | 895.00 g/mol |
| Exact Mass | 894.25 |
| IUPAC Name | 1-[4-[1-[4-[1,1,1,3,3,3-hexafluoro-2-[4-[4-[4-(2-methylbutan-2-yl)phenyl]sulfonylphenoxy]phenyl]propan-2-yl]phenoxy]propyl]phenyl]sulfonyl-4-methylbenzene |
| SMILES | CCC(Oc1ccc(C(c2ccc(Oc3ccc(S(=O)(=O)c4ccc(C(C)(C)CC)cc4)cc3)cc2)(C(F)(F)F)C(F)(F)F)cc1)c1ccc(S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C48H44F6O6S2/c1-6-44(33-10-26-41(27-11-33)61(55,56)40-24-8-32(3)9-25-40)60-39-20-14-36(15-21-39)46(47(49,50)51,48(52,53)54)35-12-18-37(19-13-35)59-38-22-30-43(31-23-38)62(57,58)42-28-16-34(17-29-42)45(4,5)7-2/h8-31,44H,6-7H2,1-5H3 |
| InChIKey | YGJPTNGZONMFEC-UHFFFAOYSA-N |
| XLogP | 13.08 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 895.00 |
| LogP ≤ 5 | 13.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |