C19H17N3O2S2 — CID 87432379
5-(4-ethynylpyrazol-1-yl)-N-[(1S,2R,3R)-2-methyl-3-phenylcyclopropyl]thiophene-2-sulfonamide (PubChem CID 87432379) has the molecular formula C19H17N3O2S2 and a molecular weight of 383.50 g/mol. Its IUPAC name is 5-(4-ethynylpyrazol-1-yl)-N-[(1S,2R,3R)-2-methyl-3-phenylcyclopropyl]thiophene-2-sulfonamide.
| Compound Name | 5-(4-ethynylpyrazol-1-yl)-N-[(1S,2R,3R)-2-methyl-3-phenylcyclopropyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 87432379 |
| Molecular Formula | C19H17N3O2S2 |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | 5-(4-ethynylpyrazol-1-yl)-N-[(1S,2R,3R)-2-methyl-3-phenylcyclopropyl]thiophene-2-sulfonamide |
| SMILES | C#Cc1cnn(-c2ccc(S(=O)(=O)N[C@H]3[C@H](C)[C@@H]3c3ccccc3)s2)c1 |
| InChI | InChI=1S/C19H17N3O2S2/c1-3-14-11-20-22(12-14)16-9-10-17(25-16)26(23,24)21-19-13(2)18(19)15-7-5-4-6-8-15/h1,4-13,18-19,21H,2H3/t13-,18-,19+/m1/s1 |
| InChIKey | HMVXLIWNKLAALH-ZNOIYHFQSA-N |
| XLogP | 3.00 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|