About [(3S)-2-oxooxolan-3-yl] 4-chlorobenzenesulfonate
[(3S)-2-oxooxolan-3-yl] 4-chlorobenzenesulfonate (PubChem CID 87432439) has the molecular formula C10H9ClO5S
and a molecular weight of 276.70 g/mol. Its IUPAC name is [(3S)-2-oxooxolan-3-yl] 4-chlorobenzenesulfonate.
Molecular Properties
| Compound Name | [(3S)-2-oxooxolan-3-yl] 4-chlorobenzenesulfonate |
| PubChem CID | 87432439 |
| Molecular Formula | C10H9ClO5S |
| Molecular Weight | 276.70 g/mol |
| Exact Mass | 275.99 |
| IUPAC Name | [(3S)-2-oxooxolan-3-yl] 4-chlorobenzenesulfonate |
| SMILES | O=C1OCC[C@@H]1OS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C10H9ClO5S/c11-7-1-3-8(4-2-7)17(13,14)16-9-5-6-15-10(9)12/h1-4,9H,5-6H2/t9-/m0/s1 |
| InChIKey | HUTFZURPZNEMBM-VIFPVBQESA-N |
| XLogP | 1.36 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.70 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [(3S)-2-oxooxolan-3-yl] 4-chlorobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S)-2-oxooxolan-3-yl] 4-chlorobenzenesulfonate?
The IUPAC name of [(3S)-2-oxooxolan-3-yl] 4-chlorobenzenesulfonate (CID 87432439) is [(3S)-2-oxooxolan-3-yl] 4-chlorobenzenesulfonate.
What is the SMILES notation for [(3S)-2-oxooxolan-3-yl] 4-chlorobenzenesulfonate?
The canonical SMILES for [(3S)-2-oxooxolan-3-yl] 4-chlorobenzenesulfonate is O=C1OCC[C@@H]1OS(=O)(=O)c1ccc(Cl)cc1.
What is the InChIKey of [(3S)-2-oxooxolan-3-yl] 4-chlorobenzenesulfonate?
The InChIKey is HUTFZURPZNEMBM-VIFPVBQESA-N. The full InChI is InChI=1S/C10H9ClO5S/c11-7-1-3-8(4-2-7)17(13,14)16-9-5-6-15-10(9)12/h1-4,9H,5-6H2/t9-/m0/s1.
What are the key properties of [(3S)-2-oxooxolan-3-yl] 4-chlorobenzenesulfonate?
[(3S)-2-oxooxolan-3-yl] 4-chlorobenzenesulfonate has a molecular weight of 276.70 g/mol, XLogP of 1.36, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S)-2-oxooxolan-3-yl] 4-chlorobenzenesulfonate is sourced from PubChem (CID 87432439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).