C25H25FN6O3 — CID 87432600
tert-butyl N-[11-(3-cyano-5-fluorophenyl)-3-methyl-10-(oxiran-2-ylmethyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-7-yl]-N-methylcarbamate (PubChem CID 87432600) has the molecular formula C25H25FN6O3 and a molecular weight of 476.51 g/mol. Its IUPAC name is tert-butyl N-[11-(3-cyano-5-fluorophenyl)-3-methyl-10-(oxiran-2-ylmethyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-7-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[11-(3-cyano-5-fluorophenyl)-3-methyl-10-(oxiran-2-ylmethyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-7-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 87432600 |
| Molecular Formula | C25H25FN6O3 |
| Molecular Weight | 476.51 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | tert-butyl N-[11-(3-cyano-5-fluorophenyl)-3-methyl-10-(oxiran-2-ylmethyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-7-yl]-N-methylcarbamate |
| SMILES | CN(C(=O)OC(C)(C)C)c1nc2c(cc(-c3cc(F)cc(C#N)c3)n2CC2CO2)c2c1ncn2C |
| InChI | InChI=1S/C25H25FN6O3/c1-25(2,3)35-24(33)31(5)23-20-21(30(4)13-28-20)18-9-19(15-6-14(10-27)7-16(26)8-15)32(22(18)29-23)11-17-12-34-17/h6-9,13,17H,11-12H2,1-5H3 |
| InChIKey | WMNHKWPRUIZSJP-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 101.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.51 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|