About 2-[3,5-bis(methoxycarbonyl)phenyl]sulfonyloxyethyl-triphenylphosphanium
2-[3,5-bis(methoxycarbonyl)phenyl]sulfonyloxyethyl-triphenylphosphanium (PubChem CID 87432761) has the molecular formula C30H28O7PS+
and a molecular weight of 563.59 g/mol. Its IUPAC name is 2-[3,5-bis(methoxycarbonyl)phenyl]sulfonyloxyethyl-triphenylphosphanium.
Molecular Properties
| Compound Name | 2-[3,5-bis(methoxycarbonyl)phenyl]sulfonyloxyethyl-triphenylphosphanium |
| PubChem CID | 87432761 |
| Molecular Formula | C30H28O7PS+ |
| Molecular Weight | 563.59 g/mol |
| Exact Mass | 563.13 |
| IUPAC Name | 2-[3,5-bis(methoxycarbonyl)phenyl]sulfonyloxyethyl-triphenylphosphanium |
| SMILES | COC(=O)c1cc(C(=O)OC)cc(S(=O)(=O)OCC[P+](c2ccccc2)(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C30H28O7PS/c1-35-29(31)23-20-24(30(32)36-2)22-28(21-23)39(33,34)37-18-19-38(25-12-6-3-7-13-25,26-14-8-4-9-15-26)27-16-10-5-11-17-27/h3-17,20-22H,18-19H2,1-2H3/q+1 |
| InChIKey | CQRAUJQOCDNXKM-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 563.59 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[3,5-bis(methoxycarbonyl)phenyl]sulfonyloxyethyl-triphenylphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3,5-bis(methoxycarbonyl)phenyl]sulfonyloxyethyl-triphenylphosphanium?
The IUPAC name of 2-[3,5-bis(methoxycarbonyl)phenyl]sulfonyloxyethyl-triphenylphosphanium (CID 87432761) is 2-[3,5-bis(methoxycarbonyl)phenyl]sulfonyloxyethyl-triphenylphosphanium.
What is the SMILES notation for 2-[3,5-bis(methoxycarbonyl)phenyl]sulfonyloxyethyl-triphenylphosphanium?
The canonical SMILES for 2-[3,5-bis(methoxycarbonyl)phenyl]sulfonyloxyethyl-triphenylphosphanium is COC(=O)c1cc(C(=O)OC)cc(S(=O)(=O)OCC[P+](c2ccccc2)(c2ccccc2)c2ccccc2)c1.
What is the InChIKey of 2-[3,5-bis(methoxycarbonyl)phenyl]sulfonyloxyethyl-triphenylphosphanium?
The InChIKey is CQRAUJQOCDNXKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H28O7PS/c1-35-29(31)23-20-24(30(32)36-2)22-28(21-23)39(33,34)37-18-19-38(25-12-6-3-7-13-25,26-14-8-4-9-15-26)27-16-10-5-11-17-27/h3-17,20-22H,18-19H2,1-2H3/q+1.
What are the key properties of 2-[3,5-bis(methoxycarbonyl)phenyl]sulfonyloxyethyl-triphenylphosphanium?
2-[3,5-bis(methoxycarbonyl)phenyl]sulfonyloxyethyl-triphenylphosphanium has a molecular weight of 563.59 g/mol, XLogP of 3.96, 10 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,5-bis(methoxycarbonyl)phenyl]sulfonyloxyethyl-triphenylphosphanium is sourced from PubChem (CID 87432761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).