C15H12N2 — CID 87432836
15,16-diazatetracyclo[8.6.1.02,7.014,17]heptadeca-1,3,5,7,9,11,14(17)-heptaene (PubChem CID 87432836) has the molecular formula C15H12N2 and a molecular weight of 220.28 g/mol. Its IUPAC name is 15,16-diazatetracyclo[8.6.1.02,7.014,17]heptadeca-1,3,5,7,9,11,14(17)-heptaene.
| Compound Name | 15,16-diazatetracyclo[8.6.1.02,7.014,17]heptadeca-1,3,5,7,9,11,14(17)-heptaene |
|---|---|
| PubChem CID | 87432836 |
| Molecular Formula | C15H12N2 |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 15,16-diazatetracyclo[8.6.1.02,7.014,17]heptadeca-1,3,5,7,9,11,14(17)-heptaene |
| SMILES | C1=CC2=CC=c3ccccc3=C3NNC(=C23)C1 |
| InChI | InChI=1S/C15H12N2/c1-2-6-12-10(4-1)8-9-11-5-3-7-13-14(11)15(12)17-16-13/h1-6,8-9,16-17H,7H2 |
| InChIKey | ICCNRHLFRDBIHM-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |