C15H15N3 — CID 87433202
15,16-diazatetracyclo[8.6.1.02,7.014,17]heptadeca-1,3,7,9,11,14(17)-hexaen-12-amine (PubChem CID 87433202) has the molecular formula C15H15N3 and a molecular weight of 237.31 g/mol. Its IUPAC name is 15,16-diazatetracyclo[8.6.1.02,7.014,17]heptadeca-1,3,7,9,11,14(17)-hexaen-12-amine.
| Compound Name | 15,16-diazatetracyclo[8.6.1.02,7.014,17]heptadeca-1,3,7,9,11,14(17)-hexaen-12-amine |
|---|---|
| PubChem CID | 87433202 |
| Molecular Formula | C15H15N3 |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | 15,16-diazatetracyclo[8.6.1.02,7.014,17]heptadeca-1,3,7,9,11,14(17)-hexaen-12-amine |
| SMILES | NC1=CC2=CC=C3CCC=CC3=C3NNC(=C23)C1 |
| InChI | InChI=1S/C15H15N3/c16-11-7-10-6-5-9-3-1-2-4-12(9)15-14(10)13(8-11)17-18-15/h2,4-7,17-18H,1,3,8,16H2 |
| InChIKey | WGYOXOYQXAKXOU-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |