About gold(1+);1H-naphthalen-1-ide-2-thiol
gold(1+);1H-naphthalen-1-ide-2-thiol (PubChem CID 87433558) has the molecular formula C10H7AuS
and a molecular weight of 356.20 g/mol. Its IUPAC name is gold(1+);1H-naphthalen-1-ide-2-thiol.
Molecular Properties
| Compound Name | gold(1+);1H-naphthalen-1-ide-2-thiol |
| PubChem CID | 87433558 |
| Molecular Formula | C10H7AuS |
| Molecular Weight | 356.20 g/mol |
| Exact Mass | 355.99 |
| IUPAC Name | gold(1+);1H-naphthalen-1-ide-2-thiol |
| SMILES | Sc1[c-]c2ccccc2cc1.[Au+] |
| InChI | InChI=1S/C10H7S.Au/c11-10-6-5-8-3-1-2-4-9(8)7-10;/h1-6,11H;/q-1;+1 |
| InChIKey | SRVDVDSBNYRIGS-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.20 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze gold(1+);1H-naphthalen-1-ide-2-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of gold(1+);1H-naphthalen-1-ide-2-thiol?
The IUPAC name of gold(1+);1H-naphthalen-1-ide-2-thiol (CID 87433558) is gold(1+);1H-naphthalen-1-ide-2-thiol.
What is the SMILES notation for gold(1+);1H-naphthalen-1-ide-2-thiol?
The canonical SMILES for gold(1+);1H-naphthalen-1-ide-2-thiol is Sc1[c-]c2ccccc2cc1.[Au+].
What is the InChIKey of gold(1+);1H-naphthalen-1-ide-2-thiol?
The InChIKey is SRVDVDSBNYRIGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7S.Au/c11-10-6-5-8-3-1-2-4-9(8)7-10;/h1-6,11H;/q-1;+1.
What are the key properties of gold(1+);1H-naphthalen-1-ide-2-thiol?
gold(1+);1H-naphthalen-1-ide-2-thiol has a molecular weight of 356.20 g/mol, XLogP of 2.93, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for gold(1+);1H-naphthalen-1-ide-2-thiol is sourced from PubChem (CID 87433558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).