About 2,2-difluoroethyl adamantane-1-carboxylate;triphenylsulfanium
2,2-difluoroethyl adamantane-1-carboxylate;triphenylsulfanium (PubChem CID 87433778) has the molecular formula C31H33F2O2S+
and a molecular weight of 507.67 g/mol. Its IUPAC name is 2,2-difluoroethyl adamantane-1-carboxylate;triphenylsulfanium.
Molecular Properties
| Compound Name | 2,2-difluoroethyl adamantane-1-carboxylate;triphenylsulfanium |
| PubChem CID | 87433778 |
| Molecular Formula | C31H33F2O2S+ |
| Molecular Weight | 507.67 g/mol |
| Exact Mass | 507.22 |
| IUPAC Name | 2,2-difluoroethyl adamantane-1-carboxylate;triphenylsulfanium |
| SMILES | O=C(OCC(F)F)C12CC3CC(CC(C3)C1)C2.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C13H18F2O2/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;14-11(15)7-17-12(16)13-4-8-1-9(5-13)3-10(2-8)6-13/h1-15H;8-11H,1-7H2/q+1; |
| InChIKey | BVPCMARBIDZMPA-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 507.67 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze 2,2-difluoroethyl adamantane-1-carboxylate;triphenylsulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-difluoroethyl adamantane-1-carboxylate;triphenylsulfanium?
The IUPAC name of 2,2-difluoroethyl adamantane-1-carboxylate;triphenylsulfanium (CID 87433778) is 2,2-difluoroethyl adamantane-1-carboxylate;triphenylsulfanium.
What is the SMILES notation for 2,2-difluoroethyl adamantane-1-carboxylate;triphenylsulfanium?
The canonical SMILES for 2,2-difluoroethyl adamantane-1-carboxylate;triphenylsulfanium is O=C(OCC(F)F)C12CC3CC(CC(C3)C1)C2.c1ccc([S+](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 2,2-difluoroethyl adamantane-1-carboxylate;triphenylsulfanium?
The InChIKey is BVPCMARBIDZMPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15S.C13H18F2O2/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;14-11(15)7-17-12(16)13-4-8-1-9(5-13)3-10(2-8)6-13/h1-15H;8-11H,1-7H2/q+1;.
What are the key properties of 2,2-difluoroethyl adamantane-1-carboxylate;triphenylsulfanium?
2,2-difluoroethyl adamantane-1-carboxylate;triphenylsulfanium has a molecular weight of 507.67 g/mol, XLogP of 7.79, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoroethyl adamantane-1-carboxylate;triphenylsulfanium is sourced from PubChem (CID 87433778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).