C20H38O2 — CID 87433807
6,9-diethyl-3,12-dimethyltetradec-7-yne-6,9-diol (PubChem CID 87433807) has the molecular formula C20H38O2 and a molecular weight of 310.52 g/mol. Its IUPAC name is 6,9-diethyl-3,12-dimethyltetradec-7-yne-6,9-diol.
| Compound Name | 6,9-diethyl-3,12-dimethyltetradec-7-yne-6,9-diol |
|---|---|
| PubChem CID | 87433807 |
| Molecular Formula | C20H38O2 |
| Molecular Weight | 310.52 g/mol |
| Exact Mass | 310.29 |
| IUPAC Name | 6,9-diethyl-3,12-dimethyltetradec-7-yne-6,9-diol |
| SMILES | CCC(C)CCC(O)(C#CC(O)(CC)CCC(C)CC)CC |
| InChI | InChI=1S/C20H38O2/c1-7-17(5)11-13-19(21,9-3)15-16-20(22,10-4)14-12-18(6)8-2/h17-18,21-22H,7-14H2,1-6H3 |
| InChIKey | CQVRVGXXSMYDBK-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.52 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|