C2H3F4NO4S2 — CID 87434293
N,1,1,1-tetrafluoro-N-methylsulfonylmethanesulfonamide (PubChem CID 87434293) has the molecular formula C2H3F4NO4S2 and a molecular weight of 245.17 g/mol. Its IUPAC name is N,1,1,1-tetrafluoro-N-methylsulfonylmethanesulfonamide.
| Compound Name | N,1,1,1-tetrafluoro-N-methylsulfonylmethanesulfonamide |
|---|---|
| PubChem CID | 87434293 |
| Molecular Formula | C2H3F4NO4S2 |
| Molecular Weight | 245.17 g/mol |
| Exact Mass | 244.94 |
| IUPAC Name | N,1,1,1-tetrafluoro-N-methylsulfonylmethanesulfonamide |
| SMILES | CS(=O)(=O)N(F)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C2H3F4NO4S2/c1-12(8,9)7(6)13(10,11)2(3,4)5/h1H3 |
| InChIKey | MHIQTZJIXLRTDH-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.17 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|