C21H26O10 — CID 87434389
2-[[2,3-bis(oxiran-2-ylmethyl)phenyl]methyl]oxirane;2-hydroxypropane-1,2,3-tricarboxylic acid (PubChem CID 87434389) has the molecular formula C21H26O10 and a molecular weight of 438.43 g/mol. Its IUPAC name is 2-[[2,3-bis(oxiran-2-ylmethyl)phenyl]methyl]oxirane;2-hydroxypropane-1,2,3-tricarboxylic acid.
| Compound Name | 2-[[2,3-bis(oxiran-2-ylmethyl)phenyl]methyl]oxirane;2-hydroxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 87434389 |
| Molecular Formula | C21H26O10 |
| Molecular Weight | 438.43 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | 2-[[2,3-bis(oxiran-2-ylmethyl)phenyl]methyl]oxirane;2-hydroxypropane-1,2,3-tricarboxylic acid |
| SMILES | O=C(O)CC(O)(CC(=O)O)C(=O)O.c1cc(CC2CO2)c(CC2CO2)c(CC2CO2)c1 |
| InChI | InChI=1S/C15H18O3.C6H8O7/c1-2-10(4-12-7-16-12)15(6-14-9-18-14)11(3-1)5-13-8-17-13;7-3(8)1-6(13,5(11)12)2-4(9)10/h1-3,12-14H,4-9H2;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | HKYSLPVWVUPMEC-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 169.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.43 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|