About O-methyl N-amino-N-(4-methyl-2-pyridinyl)carbamothioate;hydroiodide
O-methyl N-amino-N-(4-methyl-2-pyridinyl)carbamothioate;hydroiodide (PubChem CID 87434458) has the molecular formula C8H12IN3OS
and a molecular weight of 325.18 g/mol. Its IUPAC name is O-methyl N-amino-N-(4-methyl-2-pyridinyl)carbamothioate;hydroiodide.
Molecular Properties
| Compound Name | O-methyl N-amino-N-(4-methyl-2-pyridinyl)carbamothioate;hydroiodide |
| PubChem CID | 87434458 |
| Molecular Formula | C8H12IN3OS |
| Molecular Weight | 325.18 g/mol |
| Exact Mass | 324.97 |
| IUPAC Name | O-methyl N-amino-N-(4-methyl-2-pyridinyl)carbamothioate;hydroiodide |
| SMILES | COC(=S)N(N)c1cc(C)ccn1.I |
| InChI | InChI=1S/C8H11N3OS.HI/c1-6-3-4-10-7(5-6)11(9)8(13)12-2;/h3-5H,9H2,1-2H3;1H |
| InChIKey | SWUYEEFJTCSSKL-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.18 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-methyl N-amino-N-(4-methyl-2-pyridinyl)carbamothioate;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-methyl N-amino-N-(4-methyl-2-pyridinyl)carbamothioate;hydroiodide?
The IUPAC name of O-methyl N-amino-N-(4-methyl-2-pyridinyl)carbamothioate;hydroiodide (CID 87434458) is O-methyl N-amino-N-(4-methyl-2-pyridinyl)carbamothioate;hydroiodide.
What is the SMILES notation for O-methyl N-amino-N-(4-methyl-2-pyridinyl)carbamothioate;hydroiodide?
The canonical SMILES for O-methyl N-amino-N-(4-methyl-2-pyridinyl)carbamothioate;hydroiodide is COC(=S)N(N)c1cc(C)ccn1.I.
What is the InChIKey of O-methyl N-amino-N-(4-methyl-2-pyridinyl)carbamothioate;hydroiodide?
The InChIKey is SWUYEEFJTCSSKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3OS.HI/c1-6-3-4-10-7(5-6)11(9)8(13)12-2;/h3-5H,9H2,1-2H3;1H.
What are the key properties of O-methyl N-amino-N-(4-methyl-2-pyridinyl)carbamothioate;hydroiodide?
O-methyl N-amino-N-(4-methyl-2-pyridinyl)carbamothioate;hydroiodide has a molecular weight of 325.18 g/mol, XLogP of 1.62, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for O-methyl N-amino-N-(4-methyl-2-pyridinyl)carbamothioate;hydroiodide is sourced from PubChem (CID 87434458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).