About butoxymethylthiourea
butoxymethylthiourea (PubChem CID 87434548) has the molecular formula C6H14N2OS
and a molecular weight of 162.26 g/mol. Its IUPAC name is butoxymethylthiourea.
Molecular Properties
| Compound Name | butoxymethylthiourea |
| PubChem CID | 87434548 |
| Molecular Formula | C6H14N2OS |
| Molecular Weight | 162.26 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | butoxymethylthiourea |
| SMILES | CCCCOCNC(N)=S |
| InChI | InChI=1S/C6H14N2OS/c1-2-3-4-9-5-8-6(7)10/h2-5H2,1H3,(H3,7,8,10) |
| InChIKey | YRFOLPOYYFKICW-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.26 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze butoxymethylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butoxymethylthiourea?
The IUPAC name of butoxymethylthiourea (CID 87434548) is butoxymethylthiourea.
What is the SMILES notation for butoxymethylthiourea?
The canonical SMILES for butoxymethylthiourea is CCCCOCNC(N)=S.
What is the InChIKey of butoxymethylthiourea?
The InChIKey is YRFOLPOYYFKICW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2OS/c1-2-3-4-9-5-8-6(7)10/h2-5H2,1H3,(H3,7,8,10).
What are the key properties of butoxymethylthiourea?
butoxymethylthiourea has a molecular weight of 162.26 g/mol, XLogP of 0.59, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butoxymethylthiourea is sourced from PubChem (CID 87434548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).