C17H12F6N2O — CID 87434703
2-(1,8-diaminophenanthren-4-yl)-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 87434703) has the molecular formula C17H12F6N2O and a molecular weight of 374.28 g/mol. Its IUPAC name is 2-(1,8-diaminophenanthren-4-yl)-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-(1,8-diaminophenanthren-4-yl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 87434703 |
| Molecular Formula | C17H12F6N2O |
| Molecular Weight | 374.28 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | 2-(1,8-diaminophenanthren-4-yl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | Nc1cccc2c1ccc1c(N)ccc(C(O)(C(F)(F)F)C(F)(F)F)c12 |
| InChI | InChI=1S/C17H12F6N2O/c18-16(19,20)15(26,17(21,22)23)11-6-7-13(25)10-5-4-8-9(14(10)11)2-1-3-12(8)24/h1-7,26H,24-25H2 |
| InChIKey | PLXYRMNCISNIST-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.28 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|