C75H138O8 — CID 87435127
2,3-bis[[(E)-octadec-9-enoyl]oxy]propyl (E)-octadec-9-enoate;(Z)-octadec-9-enoic acid (PubChem CID 87435127) has the molecular formula C75H138O8 and a molecular weight of 1167.92 g/mol. Its IUPAC name is 2,3-bis[[(E)-octadec-9-enoyl]oxy]propyl (E)-octadec-9-enoate;(Z)-octadec-9-enoic acid.
| Compound Name | 2,3-bis[[(E)-octadec-9-enoyl]oxy]propyl (E)-octadec-9-enoate;(Z)-octadec-9-enoic acid |
|---|---|
| PubChem CID | 87435127 |
| Molecular Formula | C75H138O8 |
| Molecular Weight | 1167.92 g/mol |
| Exact Mass | 1167.04 |
| IUPAC Name | 2,3-bis[[(E)-octadec-9-enoyl]oxy]propyl (E)-octadec-9-enoate;(Z)-octadec-9-enoic acid |
| SMILES | CCCCCCCC/C=C/CCCCCCCC(=O)OCC(COC(=O)CCCCCCC/C=C/CCCCCCCC)OC(=O)CCCCCCC/C=C/CCCCCCCC.CCCCCCCC/C=C\CCCCCCCC(=O)O |
| InChI | InChI=1S/C57H104O6.C18H34O2/c1-4-7-10-13-16-19-22-25-28-31-34-37-40-43-46-49-55(58)61-52-54(63-57(60)51-48-45-42-39-36-33-30-27-24-21-18-15-12-9-6-3)53-62-56(59)50-47-44-41-38-35-32-29-26-23-20-17-14-11-8-5-2;1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h25-30,54H,4-24,31-53H2,1-3H3;9-10H,2-8,11-17H2,1H3,(H,19,20)/b28-25+,29-26+,30-27+;10-9- |
| InChIKey | XEGOGJVZKHCCIH-SIWPQTOVSA-N |
| XLogP | 24.21 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 65 |
| Heavy Atoms | 83 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1167.92 |
| LogP ≤ 5 | 24.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|