About methane;methyl prop-2-enoate
methane;methyl prop-2-enoate (PubChem CID 87435173) has the molecular formula C5H10O2
and a molecular weight of 102.13 g/mol. Its IUPAC name is methane;methyl prop-2-enoate.
Molecular Properties
| Compound Name | methane;methyl prop-2-enoate |
| PubChem CID | 87435173 |
| Molecular Formula | C5H10O2 |
| Molecular Weight | 102.13 g/mol |
| Exact Mass | 102.07 |
| IUPAC Name | methane;methyl prop-2-enoate |
| SMILES | C.C=CC(=O)OC |
| InChI | InChI=1S/C4H6O2.CH4/c1-3-4(5)6-2;/h3H,1H2,2H3;1H4 |
| InChIKey | YNSGXUFUACJPPK-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 102.13 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methane;methyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;methyl prop-2-enoate?
The IUPAC name of methane;methyl prop-2-enoate (CID 87435173) is methane;methyl prop-2-enoate.
What is the SMILES notation for methane;methyl prop-2-enoate?
The canonical SMILES for methane;methyl prop-2-enoate is C.C=CC(=O)OC.
What is the InChIKey of methane;methyl prop-2-enoate?
The InChIKey is YNSGXUFUACJPPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O2.CH4/c1-3-4(5)6-2;/h3H,1H2,2H3;1H4.
What are the key properties of methane;methyl prop-2-enoate?
methane;methyl prop-2-enoate has a molecular weight of 102.13 g/mol, XLogP of 0.98, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methane;methyl prop-2-enoate is sourced from PubChem (CID 87435173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).