About 1-iodopyrrolidine-2,5-dione;trimethylsilyl trifluoromethanesulfonate
1-iodopyrrolidine-2,5-dione;trimethylsilyl trifluoromethanesulfonate (PubChem CID 87435306) has the molecular formula C8H13F3INO5SSi
and a molecular weight of 447.25 g/mol. Its IUPAC name is 1-iodopyrrolidine-2,5-dione;trimethylsilyl trifluoromethanesulfonate.
Molecular Properties
| Compound Name | 1-iodopyrrolidine-2,5-dione;trimethylsilyl trifluoromethanesulfonate |
| PubChem CID | 87435306 |
| Molecular Formula | C8H13F3INO5SSi |
| Molecular Weight | 447.25 g/mol |
| Exact Mass | 446.93 |
| IUPAC Name | 1-iodopyrrolidine-2,5-dione;trimethylsilyl trifluoromethanesulfonate |
| SMILES | C[Si](C)(C)OS(=O)(=O)C(F)(F)F.O=C1CCC(=O)N1I |
| InChI | InChI=1S/C4H9F3O3SSi.C4H4INO2/c1-12(2,3)10-11(8,9)4(5,6)7;5-6-3(7)1-2-4(6)8/h1-3H3;1-2H2 |
| InChIKey | PCODLRQWNNRPJR-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 447.25 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze 1-iodopyrrolidine-2,5-dione;trimethylsilyl trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-iodopyrrolidine-2,5-dione;trimethylsilyl trifluoromethanesulfonate?
The IUPAC name of 1-iodopyrrolidine-2,5-dione;trimethylsilyl trifluoromethanesulfonate (CID 87435306) is 1-iodopyrrolidine-2,5-dione;trimethylsilyl trifluoromethanesulfonate.
What is the SMILES notation for 1-iodopyrrolidine-2,5-dione;trimethylsilyl trifluoromethanesulfonate?
The canonical SMILES for 1-iodopyrrolidine-2,5-dione;trimethylsilyl trifluoromethanesulfonate is C[Si](C)(C)OS(=O)(=O)C(F)(F)F.O=C1CCC(=O)N1I.
What is the InChIKey of 1-iodopyrrolidine-2,5-dione;trimethylsilyl trifluoromethanesulfonate?
The InChIKey is PCODLRQWNNRPJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9F3O3SSi.C4H4INO2/c1-12(2,3)10-11(8,9)4(5,6)7;5-6-3(7)1-2-4(6)8/h1-3H3;1-2H2.
What are the key properties of 1-iodopyrrolidine-2,5-dione;trimethylsilyl trifluoromethanesulfonate?
1-iodopyrrolidine-2,5-dione;trimethylsilyl trifluoromethanesulfonate has a molecular weight of 447.25 g/mol, XLogP of 2.17, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-iodopyrrolidine-2,5-dione;trimethylsilyl trifluoromethanesulfonate is sourced from PubChem (CID 87435306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).