C25H30N2O2 — CID 87435506
(E)-N-ethoxy-1-[3-[2-[2-[(2R)-2-methylpyrrolidin-1-yl]ethyl]-1-benzofuran-5-yl]phenyl]ethanimine (PubChem CID 87435506) has the molecular formula C25H30N2O2 and a molecular weight of 390.53 g/mol. Its IUPAC name is (E)-N-ethoxy-1-[3-[2-[2-[(2R)-2-methylpyrrolidin-1-yl]ethyl]-1-benzofuran-5-yl]phenyl]ethanimine.
| Compound Name | (E)-N-ethoxy-1-[3-[2-[2-[(2R)-2-methylpyrrolidin-1-yl]ethyl]-1-benzofuran-5-yl]phenyl]ethanimine |
|---|---|
| PubChem CID | 87435506 |
| Molecular Formula | C25H30N2O2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | (E)-N-ethoxy-1-[3-[2-[2-[(2R)-2-methylpyrrolidin-1-yl]ethyl]-1-benzofuran-5-yl]phenyl]ethanimine |
| SMILES | CCO/N=C(\C)c1cccc(-c2ccc3oc(CCN4CCC[C@H]4C)cc3c2)c1 |
| InChI | InChI=1S/C25H30N2O2/c1-4-28-26-19(3)20-8-5-9-21(15-20)22-10-11-25-23(16-22)17-24(29-25)12-14-27-13-6-7-18(27)2/h5,8-11,15-18H,4,6-7,12-14H2,1-3H3/b26-19+/t18-/m1/s1 |
| InChIKey | AGQLUSLUHUOAGQ-HCSYCCOESA-N |
| XLogP | 5.89 |
| TPSA | 37.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|