C17H21F3N6O3 — CID 87435510
N-[(2R)-2-[amino-(5-methyl-1,2,4-benzotriazin-3-yl)carbamoyl]-7,7,7-trifluoroheptyl]-N-hydroxyformamide (PubChem CID 87435510) has the molecular formula C17H21F3N6O3 and a molecular weight of 414.39 g/mol. Its IUPAC name is N-[(2R)-2-[amino-(5-methyl-1,2,4-benzotriazin-3-yl)carbamoyl]-7,7,7-trifluoroheptyl]-N-hydroxyformamide.
| Compound Name | N-[(2R)-2-[amino-(5-methyl-1,2,4-benzotriazin-3-yl)carbamoyl]-7,7,7-trifluoroheptyl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 87435510 |
| Molecular Formula | C17H21F3N6O3 |
| Molecular Weight | 414.39 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | N-[(2R)-2-[amino-(5-methyl-1,2,4-benzotriazin-3-yl)carbamoyl]-7,7,7-trifluoroheptyl]-N-hydroxyformamide |
| SMILES | Cc1cccc2nnc(N(N)C(=O)[C@H](CCCCC(F)(F)F)CN(O)C=O)nc12 |
| InChI | InChI=1S/C17H21F3N6O3/c1-11-5-4-7-13-14(11)22-16(24-23-13)26(21)15(28)12(9-25(29)10-27)6-2-3-8-17(18,19)20/h4-5,7,10,12,29H,2-3,6,8-9,21H2,1H3/t12-/m1/s1 |
| InChIKey | ZPWIDKRXAFJZQB-GFCCVEGCSA-N |
| XLogP | 2.13 |
| TPSA | 125.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.39 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|