C27H19Cl2F3N2O5 — CID 87435813
2-[3-[4-[(2,4-dichlorophenoxy)-ethylcarbamoyl]-5-[3-(trifluoromethyl)phenyl]-1,2-oxazol-3-yl]phenyl]acetic acid (PubChem CID 87435813) has the molecular formula C27H19Cl2F3N2O5 and a molecular weight of 579.36 g/mol. Its IUPAC name is 2-[3-[4-[(2,4-dichlorophenoxy)-ethylcarbamoyl]-5-[3-(trifluoromethyl)phenyl]-1,2-oxazol-3-yl]phenyl]acetic acid.
| Compound Name | 2-[3-[4-[(2,4-dichlorophenoxy)-ethylcarbamoyl]-5-[3-(trifluoromethyl)phenyl]-1,2-oxazol-3-yl]phenyl]acetic acid |
|---|---|
| PubChem CID | 87435813 |
| Molecular Formula | C27H19Cl2F3N2O5 |
| Molecular Weight | 579.36 g/mol |
| Exact Mass | 578.06 |
| IUPAC Name | 2-[3-[4-[(2,4-dichlorophenoxy)-ethylcarbamoyl]-5-[3-(trifluoromethyl)phenyl]-1,2-oxazol-3-yl]phenyl]acetic acid |
| SMILES | CCN(Oc1ccc(Cl)cc1Cl)C(=O)c1c(-c2cccc(CC(=O)O)c2)noc1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C27H19Cl2F3N2O5/c1-2-34(39-21-10-9-19(28)14-20(21)29)26(37)23-24(16-6-3-5-15(11-16)12-22(35)36)33-38-25(23)17-7-4-8-18(13-17)27(30,31)32/h3-11,13-14H,2,12H2,1H3,(H,35,36) |
| InChIKey | GXGMOHLMKATVON-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 92.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.36 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|