C27H18Cl3F3N2O5 — CID 87435898
2-[3-chloro-4-[4-[(2,4-dichlorophenoxy)-ethylcarbamoyl]-5-[4-(trifluoromethyl)phenyl]-1,2-oxazol-3-yl]phenyl]acetic acid (PubChem CID 87435898) has the molecular formula C27H18Cl3F3N2O5 and a molecular weight of 613.80 g/mol. Its IUPAC name is 2-[3-chloro-4-[4-[(2,4-dichlorophenoxy)-ethylcarbamoyl]-5-[4-(trifluoromethyl)phenyl]-1,2-oxazol-3-yl]phenyl]acetic acid.
| Compound Name | 2-[3-chloro-4-[4-[(2,4-dichlorophenoxy)-ethylcarbamoyl]-5-[4-(trifluoromethyl)phenyl]-1,2-oxazol-3-yl]phenyl]acetic acid |
|---|---|
| PubChem CID | 87435898 |
| Molecular Formula | C27H18Cl3F3N2O5 |
| Molecular Weight | 613.80 g/mol |
| Exact Mass | 612.02 |
| IUPAC Name | 2-[3-chloro-4-[4-[(2,4-dichlorophenoxy)-ethylcarbamoyl]-5-[4-(trifluoromethyl)phenyl]-1,2-oxazol-3-yl]phenyl]acetic acid |
| SMILES | CCN(Oc1ccc(Cl)cc1Cl)C(=O)c1c(-c2ccc(CC(=O)O)cc2Cl)noc1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C27H18Cl3F3N2O5/c1-2-35(40-21-10-8-17(28)13-20(21)30)26(38)23-24(18-9-3-14(11-19(18)29)12-22(36)37)34-39-25(23)15-4-6-16(7-5-15)27(31,32)33/h3-11,13H,2,12H2,1H3,(H,36,37) |
| InChIKey | DOCYFKUTCHNZTL-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 92.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.80 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|