C36H26N4O — CID 87435958
4-[15-(2,4,6-trimethylphenyl)porphyrin-5-yl]benzaldehyde (PubChem CID 87435958) has the molecular formula C36H26N4O and a molecular weight of 530.63 g/mol. Its IUPAC name is 4-[15-(2,4,6-trimethylphenyl)porphyrin-5-yl]benzaldehyde.
| Compound Name | 4-[15-(2,4,6-trimethylphenyl)porphyrin-5-yl]benzaldehyde |
|---|---|
| PubChem CID | 87435958 |
| Molecular Formula | C36H26N4O |
| Molecular Weight | 530.63 g/mol |
| Exact Mass | 530.21 |
| IUPAC Name | 4-[15-(2,4,6-trimethylphenyl)porphyrin-5-yl]benzaldehyde |
| SMILES | Cc1cc(C)c(/C2=C3\C=CC(=N3)/C=C3/C=CC(=N3)/C(c3ccc(C=O)cc3)=C3/C=CC(=N3)/C=C3/C=CC2=N3)c(C)c1 |
| InChI | InChI=1S/C36H26N4O/c1-21-16-22(2)34(23(3)17-21)36-32-14-10-28(39-32)18-26-8-12-30(37-26)35(25-6-4-24(20-41)5-7-25)31-13-9-27(38-31)19-29-11-15-33(36)40-29/h4-20H,1-3H3/b26-18-,27-19-,28-18-,29-19-,35-30-,35-31-,36-32+,36-33+ |
| InChIKey | JPJIFKYRGIZVHB-CZRTWYRXSA-N |
| XLogP | 7.37 |
| TPSA | 66.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.63 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|