C10H10F3N3OS — CID 87437025
cyano-[methyl(oxido)-λ4-sulfanylidene]-[(1S)-1-[6-(trifluoromethyl)-3-pyridinyl]ethyl]azanium (PubChem CID 87437025) has the molecular formula C10H10F3N3OS and a molecular weight of 277.27 g/mol. Its IUPAC name is cyano-[methyl(oxido)-λ4-sulfanylidene]-[(1S)-1-[6-(trifluoromethyl)-3-pyridinyl]ethyl]azanium.
| Compound Name | cyano-[methyl(oxido)-λ4-sulfanylidene]-[(1S)-1-[6-(trifluoromethyl)-3-pyridinyl]ethyl]azanium |
|---|---|
| PubChem CID | 87437025 |
| Molecular Formula | C10H10F3N3OS |
| Molecular Weight | 277.27 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | cyano-[methyl(oxido)-λ4-sulfanylidene]-[(1S)-1-[6-(trifluoromethyl)-3-pyridinyl]ethyl]azanium |
| SMILES | C[C@@H](c1ccc(C(F)(F)F)nc1)/[N+](C#N)=S(\C)[O-] |
| InChI | InChI=1S/C10H10F3N3OS/c1-7(16(6-14)18(2)17)8-3-4-9(15-5-8)10(11,12)13/h3-5,7H,1-2H3/t7-,18?/m0/s1 |
| InChIKey | ULRZXALEWPTXPH-QNUGLTPUSA-N |
| XLogP | 2.22 |
| TPSA | 62.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.27 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|