About 2-(3-benzyl-2-methylimidazol-3-ium-1-yl)ethyl acetate;3-phenylthiophen-2-ol;bromide
2-(3-benzyl-2-methylimidazol-3-ium-1-yl)ethyl acetate;3-phenylthiophen-2-ol;bromide (PubChem CID 87437158) has the molecular formula C25H27BrN2O3S
and a molecular weight of 515.47 g/mol. Its IUPAC name is 2-(3-benzyl-2-methylimidazol-3-ium-1-yl)ethyl acetate;3-phenylthiophen-2-ol;bromide.
Molecular Properties
| Compound Name | 2-(3-benzyl-2-methylimidazol-3-ium-1-yl)ethyl acetate;3-phenylthiophen-2-ol;bromide |
| PubChem CID | 87437158 |
| Molecular Formula | C25H27BrN2O3S |
| Molecular Weight | 515.47 g/mol |
| Exact Mass | 514.09 |
| IUPAC Name | 2-(3-benzyl-2-methylimidazol-3-ium-1-yl)ethyl acetate;3-phenylthiophen-2-ol;bromide |
| SMILES | CC(=O)OCCn1cc[n+](Cc2ccccc2)c1C.Oc1sccc1-c1ccccc1.[Br-] |
| InChI | InChI=1S/C15H19N2O2.C10H8OS.BrH/c1-13-16(10-11-19-14(2)18)8-9-17(13)12-15-6-4-3-5-7-15;11-10-9(6-7-12-10)8-4-2-1-3-5-8;/h3-9H,10-12H2,1-2H3;1-7,11H;1H/q+1;;/p-1 |
| InChIKey | UPQQBFISKNVSLT-UHFFFAOYSA-M |
| XLogP | 1.82 |
| TPSA | 55.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 515.47 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-benzyl-2-methylimidazol-3-ium-1-yl)ethyl acetate;3-phenylthiophen-2-ol;bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-benzyl-2-methylimidazol-3-ium-1-yl)ethyl acetate;3-phenylthiophen-2-ol;bromide?
The IUPAC name of 2-(3-benzyl-2-methylimidazol-3-ium-1-yl)ethyl acetate;3-phenylthiophen-2-ol;bromide (CID 87437158) is 2-(3-benzyl-2-methylimidazol-3-ium-1-yl)ethyl acetate;3-phenylthiophen-2-ol;bromide.
What is the SMILES notation for 2-(3-benzyl-2-methylimidazol-3-ium-1-yl)ethyl acetate;3-phenylthiophen-2-ol;bromide?
The canonical SMILES for 2-(3-benzyl-2-methylimidazol-3-ium-1-yl)ethyl acetate;3-phenylthiophen-2-ol;bromide is CC(=O)OCCn1cc[n+](Cc2ccccc2)c1C.Oc1sccc1-c1ccccc1.[Br-].
What is the InChIKey of 2-(3-benzyl-2-methylimidazol-3-ium-1-yl)ethyl acetate;3-phenylthiophen-2-ol;bromide?
The InChIKey is UPQQBFISKNVSLT-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H19N2O2.C10H8OS.BrH/c1-13-16(10-11-19-14(2)18)8-9-17(13)12-15-6-4-3-5-7-15;11-10-9(6-7-12-10)8-4-2-1-3-5-8;/h3-9H,10-12H2,1-2H3;1-7,11H;1H/q+1;;/p-1.
What are the key properties of 2-(3-benzyl-2-methylimidazol-3-ium-1-yl)ethyl acetate;3-phenylthiophen-2-ol;bromide?
2-(3-benzyl-2-methylimidazol-3-ium-1-yl)ethyl acetate;3-phenylthiophen-2-ol;bromide has a molecular weight of 515.47 g/mol, XLogP of 1.82, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-benzyl-2-methylimidazol-3-ium-1-yl)ethyl acetate;3-phenylthiophen-2-ol;bromide is sourced from PubChem (CID 87437158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).