C29H29BrN4O4 — CID 87438118
[(3R)-1-[2-oxo-2-(pyrimidin-4-ylamino)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxytricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaene-2-carboxylate bromide (PubChem CID 87438118) has the molecular formula C29H29BrN4O4 and a molecular weight of 577.48 g/mol. Its IUPAC name is [(3R)-1-[2-oxo-2-(pyrimidin-4-ylamino)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxytricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaene-2-carboxylate bromide.
| Compound Name | [(3R)-1-[2-oxo-2-(pyrimidin-4-ylamino)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxytricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaene-2-carboxylate bromide |
|---|---|
| PubChem CID | 87438118 |
| Molecular Formula | C29H29BrN4O4 |
| Molecular Weight | 577.48 g/mol |
| Exact Mass | 576.14 |
| IUPAC Name | [(3R)-1-[2-oxo-2-(pyrimidin-4-ylamino)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxytricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaene-2-carboxylate bromide |
| SMILES | O=C(C[N+]12CCC(CC1)[C@@H](OC(=O)C1(O)c3ccccc3C=Cc3ccccc31)C2)Nc1ccncn1.[Br-] |
| InChI | InChI=1S/C29H28N4O4.BrH/c34-27(32-26-11-14-30-19-31-26)18-33-15-12-22(13-16-33)25(17-33)37-28(35)29(36)23-7-3-1-5-20(23)9-10-21-6-2-4-8-24(21)29;/h1-11,14,19,22,25,36H,12-13,15-18H2;1H/t22?,25-,33?;/m0./s1 |
| InChIKey | CDMHMRMIWHWWDG-VXVSYIRNSA-N |
| XLogP | -0.01 |
| TPSA | 101.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.48 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|