C33H38ClN5O4 — CID 87438199
butyl N-[[1-[7-chloro-1-methyl-3-(naphthalen-2-ylmethyl)-2-oxo-3H-1,4-benzodiazepin-5-yl]piperidin-4-yl]amino]-N-(2-oxoethyl)carbamate (PubChem CID 87438199) has the molecular formula C33H38ClN5O4 and a molecular weight of 604.15 g/mol. Its IUPAC name is butyl N-[[1-[7-chloro-1-methyl-3-(naphthalen-2-ylmethyl)-2-oxo-3H-1,4-benzodiazepin-5-yl]piperidin-4-yl]amino]-N-(2-oxoethyl)carbamate.
| Compound Name | butyl N-[[1-[7-chloro-1-methyl-3-(naphthalen-2-ylmethyl)-2-oxo-3H-1,4-benzodiazepin-5-yl]piperidin-4-yl]amino]-N-(2-oxoethyl)carbamate |
|---|---|
| PubChem CID | 87438199 |
| Molecular Formula | C33H38ClN5O4 |
| Molecular Weight | 604.15 g/mol |
| Exact Mass | 603.26 |
| IUPAC Name | butyl N-[[1-[7-chloro-1-methyl-3-(naphthalen-2-ylmethyl)-2-oxo-3H-1,4-benzodiazepin-5-yl]piperidin-4-yl]amino]-N-(2-oxoethyl)carbamate |
| SMILES | CCCCOC(=O)N(CC=O)NC1CCN(C2=NC(Cc3ccc4ccccc4c3)C(=O)N(C)c3ccc(Cl)cc32)CC1 |
| InChI | InChI=1S/C33H38ClN5O4/c1-3-4-19-43-33(42)39(17-18-40)36-27-13-15-38(16-14-27)31-28-22-26(34)11-12-30(28)37(2)32(41)29(35-31)21-23-9-10-24-7-5-6-8-25(24)20-23/h5-12,18,20,22,27,29,36H,3-4,13-17,19,21H2,1-2H3 |
| InChIKey | IUOZMYCXJXVSBD-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 94.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.15 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|