C20H26N4O8 — CID 87438252
7,8-dimethyl-10-[(2R,3R,4S)-2,3,4,5-tetrahydroxypentyl]benzo[g]pteridine-2,4-dione;propanoic acid (PubChem CID 87438252) has the molecular formula C20H26N4O8 and a molecular weight of 450.45 g/mol. Its IUPAC name is 7,8-dimethyl-10-[(2R,3R,4S)-2,3,4,5-tetrahydroxypentyl]benzo[g]pteridine-2,4-dione;propanoic acid.
| Compound Name | 7,8-dimethyl-10-[(2R,3R,4S)-2,3,4,5-tetrahydroxypentyl]benzo[g]pteridine-2,4-dione;propanoic acid |
|---|---|
| PubChem CID | 87438252 |
| Molecular Formula | C20H26N4O8 |
| Molecular Weight | 450.45 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | 7,8-dimethyl-10-[(2R,3R,4S)-2,3,4,5-tetrahydroxypentyl]benzo[g]pteridine-2,4-dione;propanoic acid |
| SMILES | CCC(=O)O.Cc1cc2nc3c(=O)[nH]c(=O)nc-3n(C[C@@H](O)[C@@H](O)[C@@H](O)CO)c2cc1C |
| InChI | InChI=1S/C17H20N4O6.C3H6O2/c1-7-3-9-10(4-8(7)2)21(5-11(23)14(25)12(24)6-22)15-13(18-9)16(26)20-17(27)19-15;1-2-3(4)5/h3-4,11-12,14,22-25H,5-6H2,1-2H3,(H,20,26,27);2H2,1H3,(H,4,5)/t11-,12+,14-;/m1./s1 |
| InChIKey | BGPHJNJZLPSVSV-LQDWTQKMSA-N |
| XLogP | -1.24 |
| TPSA | 198.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.45 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|