C22H39NO — CID 87438307
(7Z,10Z,13Z,16Z)-1-aminodocosa-7,10,13,16-tetraen-1-ol (PubChem CID 87438307) has the molecular formula C22H39NO and a molecular weight of 333.56 g/mol. Its IUPAC name is (7Z,10Z,13Z,16Z)-1-aminodocosa-7,10,13,16-tetraen-1-ol.
| Compound Name | (7Z,10Z,13Z,16Z)-1-aminodocosa-7,10,13,16-tetraen-1-ol |
|---|---|
| PubChem CID | 87438307 |
| Molecular Formula | C22H39NO |
| Molecular Weight | 333.56 g/mol |
| Exact Mass | 333.30 |
| IUPAC Name | (7Z,10Z,13Z,16Z)-1-aminodocosa-7,10,13,16-tetraen-1-ol |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCCCC(N)O |
| InChI | InChI=1S/C22H39NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24/h6-7,9-10,12-13,15-16,22,24H,2-5,8,11,14,17-21,23H2,1H3/b7-6-,10-9-,13-12-,16-15- |
| InChIKey | MJIYCLGJHAYYGW-DOFZRALJSA-N |
| XLogP | 6.19 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.56 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|