C14H14N2O5 — CID 8743856
[2-(methylcarbamoylamino)-2-oxoethyl] 2H-chromene-3-carboxylate (PubChem CID 8743856) has the molecular formula C14H14N2O5 and a molecular weight of 290.28 g/mol. Its IUPAC name is [2-(methylcarbamoylamino)-2-oxoethyl] 2H-chromene-3-carboxylate.
| Compound Name | [2-(methylcarbamoylamino)-2-oxoethyl] 2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 8743856 |
| Molecular Formula | C14H14N2O5 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | [2-(methylcarbamoylamino)-2-oxoethyl] 2H-chromene-3-carboxylate |
| SMILES | CNC(=O)NC(=O)COC(=O)C1=Cc2ccccc2OC1 |
| InChI | InChI=1S/C14H14N2O5/c1-15-14(19)16-12(17)8-21-13(18)10-6-9-4-2-3-5-11(9)20-7-10/h2-6H,7-8H2,1H3,(H2,15,16,17,19) |
| InChIKey | PJNXMTUZRNLVAY-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |