C18H25F3SiZr — CID 87438649
[butyl(trifluoromethyl)silylidene]zirconium(2+);cyclopenta-1,3-diene;2-propylcyclopenta-1,3-diene (PubChem CID 87438649) has the molecular formula C18H25F3SiZr and a molecular weight of 417.70 g/mol. Its IUPAC name is [butyl(trifluoromethyl)silylidene]zirconium(2+);cyclopenta-1,3-diene;2-propylcyclopenta-1,3-diene.
| Compound Name | [butyl(trifluoromethyl)silylidene]zirconium(2+);cyclopenta-1,3-diene;2-propylcyclopenta-1,3-diene |
|---|---|
| PubChem CID | 87438649 |
| Molecular Formula | C18H25F3SiZr |
| Molecular Weight | 417.70 g/mol |
| Exact Mass | 416.07 |
| IUPAC Name | [butyl(trifluoromethyl)silylidene]zirconium(2+);cyclopenta-1,3-diene;2-propylcyclopenta-1,3-diene |
| SMILES | CCCC1=CC[C-]=C1.CCCC[Si](=[Zr+2])C(F)(F)F.[C-]1=CC=CC1 |
| InChI | InChI=1S/C8H11.C5H9F3Si.C5H5.Zr/c1-2-5-8-6-3-4-7-8;1-2-3-4-9-5(6,7)8;1-2-4-5-3-1;/h6-7H,2-3,5H2,1H3;2-4H2,1H3;1-3H,4H2;/q-1;;-1;+2 |
| InChIKey | SEYORXFVVILTQC-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.70 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|