About acetic acid;1-adamantylhydrazine;trichloroplatinum
acetic acid;1-adamantylhydrazine;trichloroplatinum (PubChem CID 87438850) has the molecular formula C12H22Cl3N2O2Pt
and a molecular weight of 527.76 g/mol. Its IUPAC name is acetic acid;1-adamantylhydrazine;trichloroplatinum.
Molecular Properties
| Compound Name | acetic acid;1-adamantylhydrazine;trichloroplatinum |
| PubChem CID | 87438850 |
| Molecular Formula | C12H22Cl3N2O2Pt |
| Molecular Weight | 527.76 g/mol |
| Exact Mass | 526.04 |
| IUPAC Name | acetic acid;1-adamantylhydrazine;trichloroplatinum |
| SMILES | CC(=O)O.Cl[Pt](Cl)Cl.NNC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C10H18N2.C2H4O2.3ClH.Pt/c11-12-10-4-7-1-8(5-10)3-9(2-7)6-10;1-2(3)4;;;;/h7-9,12H,1-6,11H2;1H3,(H,3,4);3*1H;/q;;;;;+3/p-3 |
| InChIKey | QNXQVEFJIFTKOP-UHFFFAOYSA-K |
| XLogP | 3.58 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 527.76 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;1-adamantylhydrazine;trichloroplatinum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;1-adamantylhydrazine;trichloroplatinum?
The IUPAC name of acetic acid;1-adamantylhydrazine;trichloroplatinum (CID 87438850) is acetic acid;1-adamantylhydrazine;trichloroplatinum.
What is the SMILES notation for acetic acid;1-adamantylhydrazine;trichloroplatinum?
The canonical SMILES for acetic acid;1-adamantylhydrazine;trichloroplatinum is CC(=O)O.Cl[Pt](Cl)Cl.NNC12CC3CC(CC(C3)C1)C2.
What is the InChIKey of acetic acid;1-adamantylhydrazine;trichloroplatinum?
The InChIKey is QNXQVEFJIFTKOP-UHFFFAOYSA-K. The full InChI is InChI=1S/C10H18N2.C2H4O2.3ClH.Pt/c11-12-10-4-7-1-8(5-10)3-9(2-7)6-10;1-2(3)4;;;;/h7-9,12H,1-6,11H2;1H3,(H,3,4);3*1H;/q;;;;;+3/p-3.
What are the key properties of acetic acid;1-adamantylhydrazine;trichloroplatinum?
acetic acid;1-adamantylhydrazine;trichloroplatinum has a molecular weight of 527.76 g/mol, XLogP of 3.58, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;1-adamantylhydrazine;trichloroplatinum is sourced from PubChem (CID 87438850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).