C19H27F3SiZr — CID 87438901
2-butylcyclopenta-1,3-diene;[butyl(trifluoromethyl)silylidene]zirconium(2+);cyclopenta-1,3-diene (PubChem CID 87438901) has the molecular formula C19H27F3SiZr and a molecular weight of 431.73 g/mol. Its IUPAC name is 2-butylcyclopenta-1,3-diene;[butyl(trifluoromethyl)silylidene]zirconium(2+);cyclopenta-1,3-diene.
| Compound Name | 2-butylcyclopenta-1,3-diene;[butyl(trifluoromethyl)silylidene]zirconium(2+);cyclopenta-1,3-diene |
|---|---|
| PubChem CID | 87438901 |
| Molecular Formula | C19H27F3SiZr |
| Molecular Weight | 431.73 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | 2-butylcyclopenta-1,3-diene;[butyl(trifluoromethyl)silylidene]zirconium(2+);cyclopenta-1,3-diene |
| SMILES | CCCCC1=CC[C-]=C1.CCCC[Si](=[Zr+2])C(F)(F)F.[C-]1=CC=CC1 |
| InChI | InChI=1S/C9H13.C5H9F3Si.C5H5.Zr/c1-2-3-6-9-7-4-5-8-9;1-2-3-4-9-5(6,7)8;1-2-4-5-3-1;/h7-8H,2-4,6H2,1H3;2-4H2,1H3;1-3H,4H2;/q-1;;-1;+2 |
| InChIKey | JWAURERWHFEFLZ-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.73 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|