C7H6F8O2 — CID 87438911
3-[1,2,2,2-tetrafluoro-1-(1,2,2,2-tetrafluoroethoxy)ethoxy]prop-1-ene (PubChem CID 87438911) has the molecular formula C7H6F8O2 and a molecular weight of 274.11 g/mol. Its IUPAC name is 3-[1,2,2,2-tetrafluoro-1-(1,2,2,2-tetrafluoroethoxy)ethoxy]prop-1-ene.
| Compound Name | 3-[1,2,2,2-tetrafluoro-1-(1,2,2,2-tetrafluoroethoxy)ethoxy]prop-1-ene |
|---|---|
| PubChem CID | 87438911 |
| Molecular Formula | C7H6F8O2 |
| Molecular Weight | 274.11 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | 3-[1,2,2,2-tetrafluoro-1-(1,2,2,2-tetrafluoroethoxy)ethoxy]prop-1-ene |
| SMILES | C=CCOC(F)(OC(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H6F8O2/c1-2-3-16-7(15,6(12,13)14)17-4(8)5(9,10)11/h2,4H,1,3H2 |
| InChIKey | TVKVCMGWACNVLU-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.11 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|