About 2,6-Difluorobenzamide
2,6-Difluorobenzamide (PubChem CID 87439) has the molecular formula C7H5F2NO
and a molecular weight of 157.12 g/mol. Its IUPAC name is 2,6-difluorobenzamide.
Molecular Properties
| Compound Name | 2,6-Difluorobenzamide |
| PubChem CID | 87439 |
| Molecular Formula | C7H5F2NO |
| Molecular Weight | 157.12 g/mol |
| Exact Mass | 157.03 |
| IUPAC Name | 2,6-difluorobenzamide |
| SMILES | C1=CC(=C(C(=C1)F)C(=O)N)F |
| InChI | InChI=1S/C7H5F2NO/c8-4-2-1-3-5(9)6(4)7(10)11/h1-3H,(H2,10,11) |
| InChIKey | AVRQBXVUUXHRMY-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 43.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | 153 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.12 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,6-Difluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-Difluorobenzamide?
The IUPAC name of 2,6-Difluorobenzamide (CID 87439) is 2,6-difluorobenzamide.
What is the SMILES notation for 2,6-Difluorobenzamide?
The canonical SMILES for 2,6-Difluorobenzamide is C1=CC(=C(C(=C1)F)C(=O)N)F.
What is the InChIKey of 2,6-Difluorobenzamide?
The InChIKey is AVRQBXVUUXHRMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5F2NO/c8-4-2-1-3-5(9)6(4)7(10)11/h1-3H,(H2,10,11).
What are the key properties of 2,6-Difluorobenzamide?
2,6-Difluorobenzamide has a molecular weight of 157.12 g/mol, XLogP of 0.30, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-Difluorobenzamide is sourced from PubChem (CID 87439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).