C26H29N3O2 — CID 87439145
3-[9-(3-morpholin-4-ylpropoxy)-1,2,3,5-tetrahydropyrrolo[2,1-a]isoquinolin-6-yl]benzonitrile (PubChem CID 87439145) has the molecular formula C26H29N3O2 and a molecular weight of 415.54 g/mol. Its IUPAC name is 3-[9-(3-morpholin-4-ylpropoxy)-1,2,3,5-tetrahydropyrrolo[2,1-a]isoquinolin-6-yl]benzonitrile.
| Compound Name | 3-[9-(3-morpholin-4-ylpropoxy)-1,2,3,5-tetrahydropyrrolo[2,1-a]isoquinolin-6-yl]benzonitrile |
|---|---|
| PubChem CID | 87439145 |
| Molecular Formula | C26H29N3O2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | 3-[9-(3-morpholin-4-ylpropoxy)-1,2,3,5-tetrahydropyrrolo[2,1-a]isoquinolin-6-yl]benzonitrile |
| SMILES | N#Cc1cccc(C2=c3ccc(OCCCN4CCOCC4)cc3=C3CCCN3C2)c1 |
| InChI | InChI=1S/C26H29N3O2/c27-18-20-4-1-5-21(16-20)25-19-29-10-2-6-26(29)24-17-22(7-8-23(24)25)31-13-3-9-28-11-14-30-15-12-28/h1,4-5,7-8,16-17H,2-3,6,9-15,19H2 |
| InChIKey | LLPBDLHISDAQHC-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 48.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|