About 2,3-diethynylbenzenethiol
2,3-diethynylbenzenethiol (PubChem CID 87439186) has the molecular formula C10H6S
and a molecular weight of 158.22 g/mol. Its IUPAC name is 2,3-diethynylbenzenethiol.
Molecular Properties
| Compound Name | 2,3-diethynylbenzenethiol |
| PubChem CID | 87439186 |
| Molecular Formula | C10H6S |
| Molecular Weight | 158.22 g/mol |
| Exact Mass | 158.02 |
| IUPAC Name | 2,3-diethynylbenzenethiol |
| SMILES | C#Cc1cccc(S)c1C#C |
| InChI | InChI=1S/C10H6S/c1-3-8-6-5-7-10(11)9(8)4-2/h1-2,5-7,11H |
| InChIKey | LTRFTQOQKSSSEO-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.22 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,3-diethynylbenzenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-diethynylbenzenethiol?
The IUPAC name of 2,3-diethynylbenzenethiol (CID 87439186) is 2,3-diethynylbenzenethiol.
What is the SMILES notation for 2,3-diethynylbenzenethiol?
The canonical SMILES for 2,3-diethynylbenzenethiol is C#Cc1cccc(S)c1C#C.
What is the InChIKey of 2,3-diethynylbenzenethiol?
The InChIKey is LTRFTQOQKSSSEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6S/c1-3-8-6-5-7-10(11)9(8)4-2/h1-2,5-7,11H.
What are the key properties of 2,3-diethynylbenzenethiol?
2,3-diethynylbenzenethiol has a molecular weight of 158.22 g/mol, XLogP of 1.94, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-diethynylbenzenethiol is sourced from PubChem (CID 87439186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).