C15H17Cl2NO — CID 874393
2,6-dichloro-N-[2-(cyclohexen-1-yl)ethyl]benzamide (PubChem CID 874393) has the molecular formula C15H17Cl2NO and a molecular weight of 298.21 g/mol. Its IUPAC name is 2,6-dichloro-N-[2-(cyclohexen-1-yl)ethyl]benzamide.
| Compound Name | 2,6-dichloro-N-[2-(cyclohexen-1-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 874393 |
| Molecular Formula | C15H17Cl2NO |
| Molecular Weight | 298.21 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 2,6-dichloro-N-[2-(cyclohexen-1-yl)ethyl]benzamide |
| SMILES | O=C(NCCC1=CCCCC1)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C15H17Cl2NO/c16-12-7-4-8-13(17)14(12)15(19)18-10-9-11-5-2-1-3-6-11/h4-5,7-8H,1-3,6,9-10H2,(H,18,19) |
| InChIKey | GLDOZZNSDYWICD-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.21 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|