C14H25NO2 — CID 87439347
methyl (E)-2-methyl-3-(2,2,6,6-tetramethylpiperidin-4-yl)prop-2-enoate (PubChem CID 87439347) has the molecular formula C14H25NO2 and a molecular weight of 239.36 g/mol. Its IUPAC name is methyl (E)-2-methyl-3-(2,2,6,6-tetramethylpiperidin-4-yl)prop-2-enoate.
| Compound Name | methyl (E)-2-methyl-3-(2,2,6,6-tetramethylpiperidin-4-yl)prop-2-enoate |
|---|---|
| PubChem CID | 87439347 |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | methyl (E)-2-methyl-3-(2,2,6,6-tetramethylpiperidin-4-yl)prop-2-enoate |
| SMILES | COC(=O)/C(C)=C/C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C14H25NO2/c1-10(12(16)17-6)7-11-8-13(2,3)15-14(4,5)9-11/h7,11,15H,8-9H2,1-6H3/b10-7+ |
| InChIKey | SAZLIHPTRNLFOY-JXMROGBWSA-N |
| XLogP | 2.66 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|