C10H6F16O2 — CID 87439552
1,1,2,2,3,3,4,4,5,5,6,6,7,8,9,10-hexadecafluorodecane-1,10-diol (PubChem CID 87439552) has the molecular formula C10H6F16O2 and a molecular weight of 462.12 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,6,7,8,9,10-hexadecafluorodecane-1,10-diol.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,8,9,10-hexadecafluorodecane-1,10-diol |
|---|---|
| PubChem CID | 87439552 |
| Molecular Formula | C10H6F16O2 |
| Molecular Weight | 462.12 g/mol |
| Exact Mass | 462.01 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,8,9,10-hexadecafluorodecane-1,10-diol |
| SMILES | OC(F)C(F)C(F)C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(O)(F)F |
| InChI | InChI=1S/C10H6F16O2/c11-1(2(12)4(14)27)3(13)5(15,16)6(17,18)7(19,20)8(21,22)9(23,24)10(25,26)28/h1-4,27-28H |
| InChIKey | VRPUFNPERXNNGE-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.12 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|