About 2-chloro-3-fluoropyridine-4-carboxylic acid;ethyl 6-chloro-2-(trifluoromethyl)pyridine-3-carboxylate
2-chloro-3-fluoropyridine-4-carboxylic acid;ethyl 6-chloro-2-(trifluoromethyl)pyridine-3-carboxylate (PubChem CID 87439911) has the molecular formula C15H10Cl2F4N2O4
and a molecular weight of 429.15 g/mol. Its IUPAC name is 2-chloro-3-fluoropyridine-4-carboxylic acid;ethyl 6-chloro-2-(trifluoromethyl)pyridine-3-carboxylate.
Molecular Properties
| Compound Name | 2-chloro-3-fluoropyridine-4-carboxylic acid;ethyl 6-chloro-2-(trifluoromethyl)pyridine-3-carboxylate |
| PubChem CID | 87439911 |
| Molecular Formula | C15H10Cl2F4N2O4 |
| Molecular Weight | 429.15 g/mol |
| Exact Mass | 428.00 |
| IUPAC Name | 2-chloro-3-fluoropyridine-4-carboxylic acid;ethyl 6-chloro-2-(trifluoromethyl)pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(Cl)nc1C(F)(F)F.O=C(O)c1ccnc(Cl)c1F |
| InChI | InChI=1S/C9H7ClF3NO2.C6H3ClFNO2/c1-2-16-8(15)5-3-4-6(10)14-7(5)9(11,12)13;7-5-4(8)3(6(10)11)1-2-9-5/h3-4H,2H2,1H3;1-2H,(H,10,11) |
| InChIKey | WWZAYANOLDZNLJ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 89.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 429.15 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-3-fluoropyridine-4-carboxylic acid;ethyl 6-chloro-2-(trifluoromethyl)pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-3-fluoropyridine-4-carboxylic acid;ethyl 6-chloro-2-(trifluoromethyl)pyridine-3-carboxylate?
The IUPAC name of 2-chloro-3-fluoropyridine-4-carboxylic acid;ethyl 6-chloro-2-(trifluoromethyl)pyridine-3-carboxylate (CID 87439911) is 2-chloro-3-fluoropyridine-4-carboxylic acid;ethyl 6-chloro-2-(trifluoromethyl)pyridine-3-carboxylate.
What is the SMILES notation for 2-chloro-3-fluoropyridine-4-carboxylic acid;ethyl 6-chloro-2-(trifluoromethyl)pyridine-3-carboxylate?
The canonical SMILES for 2-chloro-3-fluoropyridine-4-carboxylic acid;ethyl 6-chloro-2-(trifluoromethyl)pyridine-3-carboxylate is CCOC(=O)c1ccc(Cl)nc1C(F)(F)F.O=C(O)c1ccnc(Cl)c1F.
What is the InChIKey of 2-chloro-3-fluoropyridine-4-carboxylic acid;ethyl 6-chloro-2-(trifluoromethyl)pyridine-3-carboxylate?
The InChIKey is WWZAYANOLDZNLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7ClF3NO2.C6H3ClFNO2/c1-2-16-8(15)5-3-4-6(10)14-7(5)9(11,12)13;7-5-4(8)3(6(10)11)1-2-9-5/h3-4H,2H2,1H3;1-2H,(H,10,11).
What are the key properties of 2-chloro-3-fluoropyridine-4-carboxylic acid;ethyl 6-chloro-2-(trifluoromethyl)pyridine-3-carboxylate?
2-chloro-3-fluoropyridine-4-carboxylic acid;ethyl 6-chloro-2-(trifluoromethyl)pyridine-3-carboxylate has a molecular weight of 429.15 g/mol, XLogP of 4.50, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-3-fluoropyridine-4-carboxylic acid;ethyl 6-chloro-2-(trifluoromethyl)pyridine-3-carboxylate is sourced from PubChem (CID 87439911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).