C18H40NO3P — CID 87440286
1-diethoxyphosphoryl-N,N-dimethyldodecan-3-amine (PubChem CID 87440286) has the molecular formula C18H40NO3P and a molecular weight of 349.50 g/mol. Its IUPAC name is 1-diethoxyphosphoryl-N,N-dimethyldodecan-3-amine.
| Compound Name | 1-diethoxyphosphoryl-N,N-dimethyldodecan-3-amine |
|---|---|
| PubChem CID | 87440286 |
| Molecular Formula | C18H40NO3P |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.27 |
| IUPAC Name | 1-diethoxyphosphoryl-N,N-dimethyldodecan-3-amine |
| SMILES | CCCCCCCCCC(CCP(=O)(OCC)OCC)N(C)C |
| InChI | InChI=1S/C18H40NO3P/c1-6-9-10-11-12-13-14-15-18(19(4)5)16-17-23(20,21-7-2)22-8-3/h18H,6-17H2,1-5H3 |
| InChIKey | XGJLOOAQXZORLK-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|