About benzotriazol-1-ide;dioxotitanium
benzotriazol-1-ide;dioxotitanium (PubChem CID 87440324) has the molecular formula C6H4N3O2Ti-
and a molecular weight of 197.98 g/mol. Its IUPAC name is benzotriazol-1-ide;dioxotitanium.
Molecular Properties
| Compound Name | benzotriazol-1-ide;dioxotitanium |
| PubChem CID | 87440324 |
| Molecular Formula | C6H4N3O2Ti- |
| Molecular Weight | 197.98 g/mol |
| Exact Mass | 197.98 |
| IUPAC Name | benzotriazol-1-ide;dioxotitanium |
| SMILES | O=[Ti]=O.c1ccc2[n-]nnc2c1 |
| InChI | InChI=1S/C6H4N3.2O.Ti/c1-2-4-6-5(3-1)7-9-8-6;;;/h1-4H;;;/q-1;;; |
| InChIKey | XFQPBJDPZSBIAD-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 74.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.98 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze benzotriazol-1-ide;dioxotitanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzotriazol-1-ide;dioxotitanium?
The IUPAC name of benzotriazol-1-ide;dioxotitanium (CID 87440324) is benzotriazol-1-ide;dioxotitanium.
What is the SMILES notation for benzotriazol-1-ide;dioxotitanium?
The canonical SMILES for benzotriazol-1-ide;dioxotitanium is O=[Ti]=O.c1ccc2[n-]nnc2c1.
What is the InChIKey of benzotriazol-1-ide;dioxotitanium?
The InChIKey is XFQPBJDPZSBIAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N3.2O.Ti/c1-2-4-6-5(3-1)7-9-8-6;;;/h1-4H;;;/q-1;;;.
What are the key properties of benzotriazol-1-ide;dioxotitanium?
benzotriazol-1-ide;dioxotitanium has a molecular weight of 197.98 g/mol, XLogP of 0.35, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzotriazol-1-ide;dioxotitanium is sourced from PubChem (CID 87440324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).